EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O2 |
| Net Charge | 0 |
| Average Mass | 194.234 |
| Monoisotopic Mass | 194.10553 |
| SMILES | CNCCCC(=O)c1ccc(O)nc1 |
| InChI | InChI=1S/C10H14N2O2/c1-11-6-2-3-9(13)8-4-5-10(14)12-7-8/h4-5,7,11H,2-3,6H2,1H3,(H,12,14) |
| InChIKey | UMLOUOBDBGOHHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxypseudooxynicotine (CHEBI:37754) has functional parent pseudooxynicotine (CHEBI:37753) |
| 6-hydroxypseudooxynicotine (CHEBI:37754) is a aromatic ketone (CHEBI:76224) |
| 6-hydroxypseudooxynicotine (CHEBI:37754) is a monohydroxypyridine (CHEBI:38182) |
| 6-hydroxypseudooxynicotine (CHEBI:37754) is a secondary amino compound (CHEBI:50995) |
| 6-hydroxypseudooxynicotine (CHEBI:37754) is conjugate base of 6-hydroxypseudooxynicotinium(1+) (CHEBI:58682) |
| Incoming Relation(s) |
| 6-hydroxypseudooxynicotinium(1+) (CHEBI:58682) is conjugate acid of 6-hydroxypseudooxynicotine (CHEBI:37754) |
| IUPAC Name |
|---|
| 1-(6-hydroxypyridin-3-yl)-4-(methylamino)butan-1-one |
| Synonyms | Source |
|---|---|
| 1-(6-Hydroxypyrid-3-yl)-4-(methylamino)butan-1-one | KEGG COMPOUND |
| 1-(6-Hydroxypyridin-3-yl)-4-(methylamino)butan-1-one | KEGG COMPOUND |