EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30NO4 |
| Net Charge | +1 |
| Average Mass | 396.507 |
| Monoisotopic Mass | 396.21693 |
| SMILES | [NH3+]C[C@H]1CC[C@H](C(=O)Oc2ccc(CCC(=O)OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C24H29NO4/c25-16-19-6-11-21(12-7-19)24(27)29-22-13-8-18(9-14-22)10-15-23(26)28-17-20-4-2-1-3-5-20/h1-5,8-9,13-14,19,21H,6-7,10-12,15-17,25H2/p+1/t19-,21- |
| InChIKey | LPWHBGUXJFSETQ-XUTJKUGGSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzyl cetraxate(1+) (CHEBI:57790) is a ammonium ion derivative (CHEBI:35274) |
| benzyl cetraxate(1+) (CHEBI:57790) is conjugate acid of benzyl cetraxate (CHEBI:16487) |
| Incoming Relation(s) |
| benzyl cetraxate (CHEBI:16487) is conjugate base of benzyl cetraxate(1+) (CHEBI:57790) |
| IUPAC Name |
|---|
| [(1r,4r)-4-({4-[3-(benzyloxy)-3-oxopropyl]phenoxy}carbonyl)cyclohexyl]methanaminium |
| Synonym | Source |
|---|---|
| benzyl cetraxate cation | ChEBI |
| UniProt Name | Source |
|---|---|
| benzyl cetraxate | UniProt |