EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23N4O9 |
| Net Charge | -1 |
| Average Mass | 499.456 |
| Monoisotopic Mass | 499.14705 |
| SMILES | [NH3+][C@@H](CCOc1ccc(/C(=N/O)C(=O)N[C@H]2CN([C@@H](C(=O)[O-])c3ccc(O)cc3)C2=O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C23H24N4O9/c24-16(22(31)32)9-10-36-15-7-3-12(4-8-15)18(26-35)20(29)25-17-11-27(21(17)30)19(23(33)34)13-1-5-14(28)6-2-13/h1-8,16-17,19,28,35H,9-11,24H2,(H,25,29)(H,31,32)(H,33,34)/p-1/b26-18-/t16-,17-,19+/m0/s1 |
| InChIKey | CTNZOGJNVIFEBA-MOKAZRKYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isonocardicin A(1−) (CHEBI:57788) is a dicarboxylic acid anion (CHEBI:35693) |
| isonocardicin A(1−) (CHEBI:57788) is conjugate acid of isonocardicin A(2−) (CHEBI:77633) |
| isonocardicin A(1−) (CHEBI:57788) is conjugate base of isonocardicin A zwitterion (CHEBI:142510) |
| Incoming Relation(s) |
| isonocardicin A zwitterion (CHEBI:142510) is conjugate acid of isonocardicin A(1−) (CHEBI:57788) |
| isonocardicin A(2−) (CHEBI:77633) is conjugate base of isonocardicin A(1−) (CHEBI:57788) |
| IUPAC Name |
|---|
| (2S)-2-ammonio-4-{4-[(1Z)-2-({(3S)-1-[(R)-carboxylato(4-hydroxyphenyl)methyl]-2-oxoazetidin-3-yl}amino)-N-hydroxy-2-oxoethanimidoyl]phenoxy}butanoate |
| Synonym | Source |
|---|---|
| isonocardicin A anion | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ISONOCARDICIN-A | MetaCyc |