EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8ClN3O4S2 |
| Net Charge | 0 |
| Average Mass | 297.745 |
| Monoisotopic Mass | 296.96448 |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O |
| InChI | InChI=1S/C7H8ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-2,10-11H,3H2,(H2,9,12,13) |
| InChIKey | JZUFKLXOESDKRF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. diuretic An agent that promotes the excretion of urine through its effects on kidney function. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. renoprotective agent Any compound that is able to prevent damage to the kidneys. hepatoprotective agent Any compound that is able to prevent damage to the liver. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydrochlorothiazide (CHEBI:5778) has role antiatherosclerotic agent (CHEBI:145947) |
| hydrochlorothiazide (CHEBI:5778) has role antihypertensive agent (CHEBI:35674) |
| hydrochlorothiazide (CHEBI:5778) has role cardiovascular drug (CHEBI:35554) |
| hydrochlorothiazide (CHEBI:5778) has role diuretic (CHEBI:35498) |
| hydrochlorothiazide (CHEBI:5778) has role environmental contaminant (CHEBI:78298) |
| hydrochlorothiazide (CHEBI:5778) has role hepatoprotective agent (CHEBI:62868) |
| hydrochlorothiazide (CHEBI:5778) has role hypoglycemic agent (CHEBI:35526) |
| hydrochlorothiazide (CHEBI:5778) has role renoprotective agent (CHEBI:231911) |
| hydrochlorothiazide (CHEBI:5778) has role xenobiotic (CHEBI:35703) |
| hydrochlorothiazide (CHEBI:5778) is a benzothiadiazine (CHEBI:50265) |
| hydrochlorothiazide (CHEBI:5778) is a organochlorine compound (CHEBI:36683) |
| hydrochlorothiazide (CHEBI:5778) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
| INNs | Source |
|---|---|
| hidroclorotiazida | ChemIDplus |
| hydrochlorothiazide | ChemIDplus |
| hydrochlorothiazidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Carozide | ChEMBL |
| Copalia-hct | ChEMBL |
| Dafiro-hct | ChEMBL |
| Esidrix (TN) | KEGG COMPOUND |
| Exforge-hct | ChEMBL |
| Hydrochlorothiaizide | ChEMBL |
| Brand Names | Source |
|---|---|
| Apo-hydro | ChEMBL |
| Hydrochlorothiazide component of accuretic | ChEMBL |
| Hydrochlorothiazide component of aldactazide | ChEMBL |
| Hydrochlorothiazide component of aldoril | ChEMBL |
| Hydrochlorothiazide component of amturnide | ChEMBL |
| Hydrochlorothiazide component of apresazide | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1385 | DrugCentral |
| C07041 | KEGG COMPOUND |
| D00340 | KEGG DRUG |
| DB00999 | DrugBank |
| HCZ | PDBeChem |
| HMDB0001928 | HMDB |
| Hydrochlorothiazide | Wikipedia |
| LSM-5308 | LINCS |
| Citations |
|---|