EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6NO3 |
| Net Charge | -1 |
| Average Mass | 140.118 |
| Monoisotopic Mass | 140.03532 |
| SMILES | O=C1CCC(C(=O)[O-])=CN1 |
| InChI | InChI=1S/C6H7NO3/c8-5-2-1-4(3-7-5)6(9)10/h3H,1-2H2,(H,7,8)(H,9,10)/p-1 |
| InChIKey | SDKCWSUZEUBWLP-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4,5,6-tetrahydro-6-oxonicotinate (CHEBI:57777) is a 4-oxo monocarboxylic acid anion (CHEBI:35974) |
| 1,4,5,6-tetrahydro-6-oxonicotinate (CHEBI:57777) is conjugate base of 1,4,5,6-tetrahydro-6-oxonicotinic acid (CHEBI:16453) |
| Incoming Relation(s) |
| 1,4,5,6-tetrahydro-6-oxonicotinic acid (CHEBI:16453) is conjugate acid of 1,4,5,6-tetrahydro-6-oxonicotinate (CHEBI:57777) |
| IUPAC Name |
|---|
| 6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate |
| Synonym | Source |
|---|---|
| 1,4,5,6-tetrahydro-6-oxonicotinate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 1,4,5,6-tetrahydro-6-oxonicotinate | UniProt |