EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15O7 |
| Net Charge | -1 |
| Average Mass | 319.289 |
| Monoisotopic Mass | 319.08233 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)O[C@@H]1CC(C(=O)[O-])=C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H16O7/c17-11-4-1-9(2-5-11)3-6-14(19)23-13-8-10(16(21)22)7-12(18)15(13)20/h1-7,12-13,15,17-18,20H,8H2,(H,21,22)/p-1/b6-3+/t12-,13-,15-/m1/s1 |
| InChIKey | GVECSFFLZYNEBO-PDXJTRCTSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-coumaroylshikimate (CHEBI:57768) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 4-coumaroylshikimate (CHEBI:57768) is conjugate base of 4-coumaroylshikimic acid (CHEBI:16428) |
| Incoming Relation(s) |
| 4-coumaroylshikimic acid (CHEBI:16428) is conjugate acid of 4-coumaroylshikimate (CHEBI:57768) |
| IUPAC Name |
|---|
| (3R,4R,5R)-3,4-dihydroxy-5-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyloxy]cyclohex-1-ene-1-carboxylate |
| Synonyms | Source |
|---|---|
| 4-coumaroylshikimate(1−) | ChEBI |
| 4-coumaroylshikimate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| trans-4-coumaroylshikimate | UniProt |