EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | CC(C)[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | KZSNJWFQEVHDMF-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-valine zwitterion (CHEBI:57762) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-valine zwitterion (CHEBI:57762) is tautomer of L-valine (CHEBI:16414) |
| Incoming Relation(s) |
| L-valine (CHEBI:16414) is tautomer of L-valine zwitterion (CHEBI:57762) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-methylbutanoate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-3-methylbutanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| L-valine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2826 | Gmelin |