EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4NO4 |
| Net Charge | -1 |
| Average Mass | 154.101 |
| Monoisotopic Mass | 154.01458 |
| SMILES | O=[N+]([O-])c1ccc([O-])c(O)c1 |
| InChI | InChI=1S/C6H5NO4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H/p-1 |
| InChIKey | XJNPNXSISMKQEX-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-4-nitrophenolate (CHEBI:57730) has role human xenobiotic metabolite (CHEBI:76967) |
| 2-hydroxy-4-nitrophenolate (CHEBI:57730) is a phenolate anion (CHEBI:50525) |
| 2-hydroxy-4-nitrophenolate (CHEBI:57730) is conjugate base of 4-nitrocatechol (CHEBI:16318) |
| Incoming Relation(s) |
| 4-nitrocatechol (CHEBI:16318) is conjugate acid of 2-hydroxy-4-nitrophenolate (CHEBI:57730) |
| IUPAC Name |
|---|
| 2-hydroxy-4-nitrophenolate |
| Synonyms | Source |
|---|---|
| 2-hydroxy-4-nitrobenzen-1-olate | ChEBI |
| 4-nitrocatechol-1-ate | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-nitrocatechol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3949299 | Reaxys |