EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18NO3 |
| Net Charge | +1 |
| Average Mass | 284.335 |
| Monoisotopic Mass | 284.12812 |
| SMILES | C[NH+]1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C17H17NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,16,19H,6-8H2,1H3/p+1/t10-,11+,16-,17-/m0/s1 |
| InChIKey | PFBSOANQDDTNGJ-YNHQPCIGSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| morphiniumone(1+) (CHEBI:57728) is a ammonium ion derivative (CHEBI:35274) |
| morphiniumone(1+) (CHEBI:57728) is conjugate acid of morphinone (CHEBI:16315) |
| Incoming Relation(s) |
| morphinone (CHEBI:16315) is conjugate base of morphiniumone(1+) (CHEBI:57728) |
| IUPAC Name |
|---|
| 3-hydroxy-17-methyl-7,8-didehydro-4,5-epoxy-5α-morphinan-17-ium-6-one |
| Synonyms | Source |
|---|---|
| morphiniumone cation | ChEBI |
| morphinone cation | ChEBI |
| UniProt Name | Source |
|---|---|
| morphinone | UniProt |