EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H2N2O3 |
| Net Charge | -2 |
| Average Mass | 126.071 |
| Monoisotopic Mass | 126.00764 |
| SMILES | O=c1[c-]c(=O)[n-]c(=O)n1 |
| InChI | InChI=1S/C4H3N2O3/c7-2-1-3(8)6-4(9)5-2/h1H,(H2,5,6,7,8,9)/q-1/p-1 |
| InChIKey | GVLZYMDNTPNTLV-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| barbiturate(2−) (CHEBI:57718) is a organic anion (CHEBI:25696) |
| barbiturate(2−) (CHEBI:57718) is conjugate base of barbituric acid (CHEBI:16294) |
| Incoming Relation(s) |
| barbituric acid (CHEBI:16294) is conjugate acid of barbiturate(2−) (CHEBI:57718) |
| IUPAC Name |
|---|
| 2,4,6-trioxotetrahydro-2H-pyrimidine-1,5-diide |
| Synonyms | Source |
|---|---|
| barbiturate dianion | ChEBI |
| 2,4,6-trioxo-1,3-diazinane-1,5-diide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7973338 | Beilstein |