EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5O6 |
| Net Charge | -3 |
| Average Mass | 209.133 |
| Monoisotopic Mass | 209.01026 |
| SMILES | O=C([O-])C=C(/C=C\C(=O)[O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C9H8O6/c10-7(11)3-1-6(5-9(14)15)2-4-8(12)13/h1-5H,(H,10,11)(H,12,13)(H,14,15)/p-3/b3-1-,4-2- |
| InChIKey | WKDXBDTUVVLFQV-CCAGOZQPSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2-carboxylatoethenyl)-cis,cis-muconate(3−) (CHEBI:57713) is a tricarboxylic acid trianion (CHEBI:27092) |
| 3-(2-carboxylatoethenyl)-cis,cis-muconate(3−) (CHEBI:57713) is conjugate base of 3-(2-carboxyethenyl)-cis,cis-muconic acid (CHEBI:16281) |
| Incoming Relation(s) |
| 3-(2-carboxyethenyl)-cis,cis-muconic acid (CHEBI:16281) is conjugate acid of 3-(2-carboxylatoethenyl)-cis,cis-muconate(3−) (CHEBI:57713) |
| IUPAC Name |
|---|
| (2Z,5Z)-4-(carboxylatomethylidene)hepta-2,5-dienedioate |
| Synonym | Source |
|---|---|
| 3-(2-carboxylatoethenyl)-cis,cis-muconate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-(2-carboxyethenyl)-cis,cis-muconate | UniProt |