EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14N3O8 |
| Net Charge | -1 |
| Average Mass | 424.345 |
| Monoisotopic Mass | 424.07864 |
| SMILES | [NH3+]C(CC(=O)c1cccc2c1Nc1c(cc(O)c3nc(C(=O)[O-])cc(O)c13)O2)C(=O)[O-] |
| InChI | InChI=1S/C20H15N3O8/c21-8(19(27)28)4-10(24)7-2-1-3-13-16(7)23-18-14(31-13)6-12(26)17-15(18)11(25)5-9(22-17)20(29)30/h1-3,5-6,8,23,26H,4,21H2,(H,22,25)(H,27,28)(H,29,30)/p-1 |
| InChIKey | WSRZQBTZCCBWOL-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,12-dihydroxanthommatin(1−) (CHEBI:57710) is a dicarboxylic acid anion (CHEBI:35693) |
| 5,12-dihydroxanthommatin(1−) (CHEBI:57710) is conjugate base of 5,12-dihydroxanthommatin (CHEBI:16274) |
| Incoming Relation(s) |
| 5,12-dihydroxanthommatin (CHEBI:16274) is conjugate acid of 5,12-dihydroxanthommatin(1−) (CHEBI:57710) |
| IUPAC Name |
|---|
| 11-(3-azaniumyl-3-carboxylatopropanoyl)-1,5-dihydroxy-12H-pyrido[3,2-a]phenoxazine-3-carboxylate |
| Synonym | Source |
|---|---|
| 5,12-dihydroxanthommatin anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 5,12-dihydroxanthommatin | UniProt |