EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4NO3 |
| Net Charge | -1 |
| Average Mass | 138.102 |
| Monoisotopic Mass | 138.01967 |
| SMILES | O=[N+]([O-])c1ccccc1[O-] |
| InChI | InChI=1S/C6H5NO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H/p-1 |
| InChIKey | IQUPABOKLQSFBK-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitrophenolate (CHEBI:57703) is a phenolate anion (CHEBI:50525) |
| 2-nitrophenolate (CHEBI:57703) is conjugate base of 2-nitrophenol (CHEBI:16260) |
| Incoming Relation(s) |
| 2-nitrophenol (CHEBI:16260) is conjugate acid of 2-nitrophenolate (CHEBI:57703) |
| IUPAC Name |
|---|
| 2-nitrophenolate |
| UniProt Name | Source |
|---|---|
| 2-nitrophenol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:327584 | Gmelin |
| Beilstein:3542179 | Beilstein |