EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N7O6 |
| Net Charge | +1 |
| Average Mass | 424.438 |
| Monoisotopic Mass | 424.19391 |
| SMILES | CN(CCC([NH3+])CC(=O)N[C@H]1C=C[C@H](n2ccc(=O)nc2=O)O[C@@H]1C(=O)[O-])C(N)=[NH2+] |
| InChI | InChI=1S/C17H25N7O6/c1-23(16(19)20)6-4-9(18)8-12(26)21-10-2-3-13(30-14(10)15(27)28)24-7-5-11(25)22-17(24)29/h2-3,5,7,9-10,13-14H,4,6,8,18H2,1H3,(H3,19,20)(H,21,26)(H,27,28)(H,22,25,29)/p+1/t9?,10-,13+,14-/m0/s1 |
| InChIKey | REIIQZAQCCFGIJ-LBLJTAPMSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deaminohydroxyblasticidin S(1+) (CHEBI:57697) is a ammonium ion derivative (CHEBI:35274) |
| deaminohydroxyblasticidin S(1+) (CHEBI:57697) is conjugate acid of deaminohydroxyblasticidin S (CHEBI:16251) |
| Incoming Relation(s) |
| deaminohydroxyblasticidin S (CHEBI:16251) is conjugate base of deaminohydroxyblasticidin S(1+) (CHEBI:57697) |
| Synonym | Source |
|---|---|
| deaminohydroxyblasticidin S cation | ChEBI |
| UniProt Name | Source |
|---|---|
| deaminohydroxyblasticidin S | UniProt |