EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H2ClO4 |
| Net Charge | -1 |
| Average Mass | 173.531 |
| Monoisotopic Mass | 172.96471 |
| SMILES | O=C([O-])/C=C1\C=C(Cl)C(=O)O1 |
| InChI | InChI=1S/C6H3ClO4/c7-4-1-3(2-5(8)9)11-6(4)10/h1-2H,(H,8,9)/p-1/b3-2+ |
| InChIKey | ADSGHWJRPOXXTD-NSCUHMNNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-2-chloro-4-carboxylatomethylenebut-2-en-1,4-olide (CHEBI:57681) is a monocarboxylic acid anion (CHEBI:35757) |
| cis-2-chloro-4-carboxylatomethylenebut-2-en-1,4-olide (CHEBI:57681) is conjugate base of cis-2-chloro-4-carboxymethylenebut-2-en-1,4-olide (CHEBI:16211) |
| Incoming Relation(s) |
| cis-2-chloro-4-carboxymethylenebut-2-en-1,4-olide (CHEBI:16211) is conjugate acid of cis-2-chloro-4-carboxylatomethylenebut-2-en-1,4-olide (CHEBI:57681) |
| IUPAC Name |
|---|
| (2E)-(4-chloro-5-oxofuran-2(5H)-ylidene)acetate |
| UniProt Name | Source |
|---|---|
| cis-2-chloro-4-carboxymethylenebut-2-en-1,4-olide | UniProt |