EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H39O6P |
| Net Charge | -2 |
| Average Mass | 442.533 |
| Monoisotopic Mass | 442.24952 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COC[C@H](O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C23H41O6P/c1-19(2)9-6-10-20(3)11-7-12-21(4)13-8-14-22(5)15-16-28-17-23(24)18-29-30(25,26)27/h9,11,13,15,23-24H,6-8,10,12,14,16-18H2,1-5H3,(H2,25,26,27)/p-2/b20-11+,21-13+,22-15+/t23-/m0/s1 |
| InChIKey | BJLPWUCPFAJINB-UAQSTNRTSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sn-3-O-(geranylgeranyl)glycerol 1-phosphate(2−) (CHEBI:57677) is a organophosphate oxoanion (CHEBI:58945) |
| sn-3-O-(geranylgeranyl)glycerol 1-phosphate(2−) (CHEBI:57677) is conjugate base of sn-3-O-(geranylgeranyl)glycerol 1-phosphate (CHEBI:16206) |
| Incoming Relation(s) |
| sn-3-O-(geranylgeranyl)glycerol 1-phosphate (CHEBI:16206) is conjugate acid of sn-3-O-(geranylgeranyl)glycerol 1-phosphate(2−) (CHEBI:57677) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yloxy]propyl phosphate |
| Synonym | Source |
|---|---|
| sn-3-O-(geranylgeranyl)glycerol 1-phosphate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| sn-3-O-(geranylgeranyl)glycerol 1-phosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1031158 | Beilstein |