EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17O7P2 |
| Net Charge | -3 |
| Average Mass | 311.187 |
| Monoisotopic Mass | 311.04660 |
| SMILES | CC(C)=CCC/C(C)=C\COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C10H20O7P2/c1-9(2)5-4-6-10(3)7-8-16-19(14,15)17-18(11,12)13/h5,7H,4,6,8H2,1-3H3,(H,14,15)(H2,11,12,13)/p-3/b10-7- |
| InChIKey | GVVPGTZRZFNKDS-YFHOEESVSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neryl diphosphate(3−) (CHEBI:57665) is a organophosphate oxoanion (CHEBI:58945) |
| neryl diphosphate(3−) (CHEBI:57665) is conjugate base of neryl diphosphate (CHEBI:16172) |
| Incoming Relation(s) |
| neryl diphosphate (CHEBI:16172) is conjugate acid of neryl diphosphate(3−) (CHEBI:57665) |
| IUPAC Name |
|---|
| (2Z)-3,7-dimethylocta-2,6-dien-1-yl diphosphate |
| Synonym | Source |
|---|---|
| neryl diphosphate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| neryl diphosphate | UniProt |