EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O15P2 |
| Net Charge | -2 |
| Average Mass | 546.315 |
| Monoisotopic Mass | 546.06629 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])OC3O[C@@H](C)[C@](O)(CO)[C@H]3O)O2)c(=O)nc1=O |
| InChI | InChI=1S/C16H26N2O15P2/c1-7-4-18(15(23)17-13(7)22)11-3-9(20)10(31-11)5-29-34(25,26)33-35(27,28)32-14-12(21)16(24,6-19)8(2)30-14/h4,8-12,14,19-21,24H,3,5-6H2,1-2H3,(H,25,26)(H,27,28)(H,17,22,23)/p-2/t8-,9-,10+,11+,12-,14?,16+/m0/s1 |
| InChIKey | LOULRGSWJAXPFN-RJJWCKLQSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTDP-L-dihydrostreptose(2−) (CHEBI:57631) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| dTDP-L-dihydrostreptose(2−) (CHEBI:57631) is conjugate base of dTDP-L-dihydrostreptose (CHEBI:16081) |
| Incoming Relation(s) |
| dTDP-L-dihydrostreptose (CHEBI:16081) is conjugate acid of dTDP-L-dihydrostreptose(2−) (CHEBI:57631) |
| IUPAC Name |
|---|
| thymidine 5'-{3-[5-deoxy-3-C-(hydroxymethyl)-L-lyxofuranosyl] diphosphate} |
| Synonym | Source |
|---|---|
| dTDP-L-dihydrostreptose anion | ChEBI |
| UniProt Name | Source |
|---|---|
| dTDP-L-dihydrostreptose | UniProt |