EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41O14 |
| Net Charge | -1 |
| Average Mass | 649.666 |
| Monoisotopic Mass | 649.25018 |
| SMILES | [H][C@]12CC[C@@](C)([C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3ccoc3)[C@@]3(O[C@@H]3C(=O)[O-])[C@]1(C)C(=O)C[C@@]1([H])C(C)(C)O[C@@]3([H])CC(=O)OC[C@@]213 |
| InChI | InChI=1S/C32H42O14/c1-28(2)17-9-18(34)30(4)16(31(17)13-42-20(35)10-19(31)45-28)5-7-29(3,32(30)25(46-32)26(39)40)24(14-6-8-41-12-14)44-27-23(38)22(37)21(36)15(11-33)43-27/h6,8,12,15-17,19,21-25,27,33,36-38H,5,7,9-11,13H2,1-4H3,(H,39,40)/p-1/t15-,16+,17+,19+,21-,22+,23-,24+,25-,27+,29+,30+,31-,32-/m1/s1 |
| InChIKey | FYIKIBQJAJRKQM-WNCNYDOCSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| limonin 17-β-D-glucoside(1−) (CHEBI:57626) is a 5-oxo monocarboxylic acid anion (CHEBI:35975) |
| limonin 17-β-D-glucoside(1−) (CHEBI:57626) is a epoxy monocarboxylic acid (CHEBI:23931) |
| limonin 17-β-D-glucoside(1−) (CHEBI:57626) is a β-D-glucoside (CHEBI:22798) |
| limonin 17-β-D-glucoside(1−) (CHEBI:57626) is conjugate base of limonin 17-β-D-glucoside (CHEBI:16063) |
| Incoming Relation(s) |
| limonin 17-β-D-glucoside (CHEBI:16063) is conjugate acid of limonin 17-β-D-glucoside(1−) (CHEBI:57626) |
| IUPAC Name |
|---|
| (3'S,4aS,6aR,8aR,9R,10S,12aR,12bR)-10-[(R)-furan-3-yl(β-D-glucopyranosyloxy)methyl]-6,6,8a,10-tetramethyl-3,8-dioxodecahydro-3H,6H-spiro[naphtho[1',2':3,4]furo[3,2-c]pyran-9,2'-oxirane]-3'-carboxylate |
| Synonym | Source |
|---|---|
| limonin 17-β-D-glucoside anion | ChEBI |
| UniProt Name | Source |
|---|---|
| limonin 17-β-D-glucoside | UniProt |