EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O7P2 |
| Net Charge | -3 |
| Average Mass | 243.068 |
| Monoisotopic Mass | 242.98400 |
| SMILES | CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8)/p-3 |
| InChIKey | CBIDRCWHNCKSTO-UHFFFAOYSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). phosphoantigen Any antigen that is a phosphorylated microbial metabolite which activates an immune response in humans. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prenyl diphosphate(3−) (CHEBI:57623) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| prenyl diphosphate(3−) (CHEBI:57623) has role epitope (CHEBI:53000) |
| prenyl diphosphate(3−) (CHEBI:57623) has role human metabolite (CHEBI:77746) |
| prenyl diphosphate(3−) (CHEBI:57623) has role phosphoantigen (CHEBI:59544) |
| prenyl diphosphate(3−) (CHEBI:57623) is a organophosphate oxoanion (CHEBI:58945) |
| prenyl diphosphate(3−) (CHEBI:57623) is conjugate base of prenyl diphosphate (CHEBI:16057) |
| Incoming Relation(s) |
| prenyl diphosphate (CHEBI:16057) is conjugate acid of prenyl diphosphate(3−) (CHEBI:57623) |
| IUPAC Name |
|---|
| 3-methylbut-2-en-1-yl diphosphate |
| Synonyms | Source |
|---|---|
| dimethylallyl pyrophosphate | ChEBI |
| Dimethylallyl pyrophosphate trianion | ChEBI |
| prenyl diphosphate trianion | ChEBI |
| prenyl pyrophosphate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| dimethylallyl diphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5288443 | Reaxys |
| CAS:22679-02-3 | Reaxys |
| Citations |
|---|