EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C5H10O7P)n.H2O |
| Net Charge | -1 |
| Average Mass | 231.117 |
| Monoisotopic Mass | 231.02753 |
| SMILES | [H]OC[C@H](O)[C@H](O)[C@H](O)COP(=O)([O-])O |
| InChI | InChI=1S/C5H13O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h3-9H,1-2H2,(H2,10,11,12)/p-1/t3-,4+,5-/m0/s1 |
| InChIKey | VJDOAZKNBQCAGE-LMVFSUKVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| poly(ribitol phosphate) polyanion (CHEBI:57620) is a organophosphate oxoanion (CHEBI:58945) |
| poly(ribitol phosphate) polyanion (CHEBI:57620) is a poly(ribitol phosphate)s (CHEBI:26172) |
| poly(ribitol phosphate) polyanion (CHEBI:57620) is conjugate base of poly(ribitol phosphate) (CHEBI:16051) |
| Incoming Relation(s) |
| poly(ribitol phosphate) (CHEBI:16051) is conjugate acid of poly(ribitol phosphate) polyanion (CHEBI:57620) |
| IUPAC Name |
|---|
| poly{[(1S,2S,3R)-1,2,3-trihydroxybutane-1,4-diyl]oxyphosphinatooxy} |
| Synonym | Source |
|---|---|
| poly(ribitol phosphate) anion | ChEBI |