EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38N8O4 |
| Net Charge | 0 |
| Average Mass | 550.664 |
| Monoisotopic Mass | 550.30160 |
| SMILES | N=C(N)NCCCCNC(=O)/C=C/c1ccc2c(c1)[C@H](C(=O)NCCCCNC(=N)N)[C@@H](c1ccc(O)cc1)O2 |
| InChI | InChI=1S/C28H38N8O4/c29-27(30)35-15-3-1-13-33-23(38)12-6-18-5-11-22-21(17-18)24(25(40-22)19-7-9-20(37)10-8-19)26(39)34-14-2-4-16-36-28(31)32/h5-12,17,24-25,37H,1-4,13-16H2,(H,33,38)(H,34,39)(H4,29,30,35)(H4,31,32,36)/b12-6+/t24-,25+/m0/s1 |
| InChIKey | KVYNYRIOAYQBFK-AIIPJEMGSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. |
| Application: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hordatine A (CHEBI:5762) has functional parent p-coumaroylagmatine (CHEBI:32818) |
| hordatine A (CHEBI:5762) has role adrenergic antagonist (CHEBI:37887) |
| hordatine A (CHEBI:5762) has role metabolite (CHEBI:25212) |
| hordatine A (CHEBI:5762) is a aromatic ether (CHEBI:35618) |
| hordatine A (CHEBI:5762) is a benzofurans (CHEBI:35259) |
| hordatine A (CHEBI:5762) is a dicarboxylic acid diamide (CHEBI:35779) |
| hordatine A (CHEBI:5762) is a guanidines (CHEBI:24436) |
| hordatine A (CHEBI:5762) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2S,3S)-N-(4-carbamimidamidobutyl)-5-{(1E)-3-[(4-carbamimidamidobutyl)amino]-3-oxoprop-1-en-1-yl}-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| C00001415 | KNApSAcK |
| C08307 | KEGG COMPOUND |
| HMDB0030461 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:7073-64-5 | KEGG COMPOUND |
| Citations |
|---|