EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9N3O2 |
| Net Charge | 0 |
| Average Mass | 131.135 |
| Monoisotopic Mass | 131.06948 |
| SMILES | NC(=[NH2+])NCCC(=O)[O-] |
| InChI | InChI=1S/C4H9N3O2/c5-4(6)7-2-1-3(8)9/h1-2H2,(H,8,9)(H4,5,6,7) |
| InChIKey | KMXXSJLYVJEBHI-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-guanidinopropanoic acid zwitterion (CHEBI:57593) is a zwitterion (CHEBI:27369) |
| 3-guanidinopropanoic acid zwitterion (CHEBI:57593) is tautomer of 3-guanidinopropanoic acid (CHEBI:15968) |
| Incoming Relation(s) |
| 3-guanidinopropanoic acid (CHEBI:15968) is tautomer of 3-guanidinopropanoic acid zwitterion (CHEBI:57593) |
| IUPAC Name |
|---|
| 3-{[amino(iminio)methyl]amino}propanoate |
| UniProt Name | Source |
|---|---|
| 3-guanidinopropanoate | UniProt |