EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO4 |
| Net Charge | 0 |
| Average Mass | 203.238 |
| Monoisotopic Mass | 203.11576 |
| SMILES | CC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C9H17NO4/c1-7(11)14-8(5-9(12)13)6-10(2,3)4/h8H,5-6H2,1-4H3/t8-/m1/s1 |
| InChIKey | RDHQFKQIGNGIED-MRVPVSSYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) | ||
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-acetyl-L-carnitine (CHEBI:57589) has functional parent carnitine (CHEBI:17126) |
| O-acetyl-L-carnitine (CHEBI:57589) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| O-acetyl-L-carnitine (CHEBI:57589) has role antineoplastic agent (CHEBI:35610) |
| O-acetyl-L-carnitine (CHEBI:57589) has role antipsychotic agent (CHEBI:35476) |
| O-acetyl-L-carnitine (CHEBI:57589) has role human metabolite (CHEBI:77746) |
| O-acetyl-L-carnitine (CHEBI:57589) has role hypoglycemic agent (CHEBI:35526) |
| O-acetyl-L-carnitine (CHEBI:57589) is a O-acetylcarnitine (CHEBI:73024) |
| O-acetyl-L-carnitine (CHEBI:57589) is a saturated fatty acyl-L-carnitine (CHEBI:133445) |
| O-acetyl-L-carnitine (CHEBI:57589) is enantiomer of O-acetyl-D-carnitine (CHEBI:86045) |
| Incoming Relation(s) |
| O-acetyl-D-carnitine (CHEBI:86045) is enantiomer of O-acetyl-L-carnitine (CHEBI:57589) |
| IUPAC Name |
|---|
| (3R)-3-(acetyloxy)-4-(trimethylazaniumyl)butanoate |
| Synonyms | Source |
|---|---|
| acetylcarnitine | ChEMBL |
| (-)-Acetylcarnitine | ChemIDplus |
| Acetyl carnitine hcl | ChEMBL |
| Acetylcarnitine hydrochloride, l- | ChEMBL |
| Acetyl-L-(-)-carnitine | ChemIDplus |
| Acetyl-L-carnitine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Oristar acc | ChEMBL |
| UniProt Name | Source |
|---|---|
| O-acetyl-(R)-carnitine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 64 | DrugCentral |
| Acetyl-L-carnitine | Wikipedia |
| C02571 | KEGG COMPOUND |
| HMDB0000201 | HMDB |
| O-ACETYLCARNITINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3667658 | Reaxys |
| CAS:3040-38-8 | ChemIDplus |
| Citations |
|---|