EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C3H6O5P)n.C3H7O6P |
| Net Charge | -3 |
| Average Mass | 323.107 |
| Monoisotopic Mass | 322.99496 |
| SMILES | O=P([O-])([O-])OCC(O)COP(=O)([O-])OCC(O)CO |
| InChI | InChI=1S/C6H16O11P2/c7-1-5(8)2-16-19(13,14)17-4-6(9)3-15-18(10,11)12/h5-9H,1-4H2,(H,13,14)(H2,10,11,12)/p-3 |
| InChIKey | QOLQOWHPTBTMKS-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| poly(glycerol phosphate) anion macromolecule (CHEBI:57577) is a homopolymer macromolecule (CHEBI:37997) |
| poly(glycerol phosphate) anion macromolecule (CHEBI:57577) is a organophosphate oxoanion (CHEBI:58945) |
| poly(glycerol phosphate) anion macromolecule (CHEBI:57577) is conjugate base of poly(glycerol phosphate) macromolecule (CHEBI:15943) |
| Incoming Relation(s) |
| poly(glycerol phosphate) macromolecule (CHEBI:15943) is conjugate acid of poly(glycerol phosphate) anion macromolecule (CHEBI:57577) |
| IUPAC Name |
|---|
| α-[(2,3-dihydroxypropoxy)phosphinato]-ω-oxidopoly[oxy(2-hydroxypropane-1,3-diyl)oxyphosphinato] |
| Synonym | Source |
|---|---|
| poly(glycerol phosphate) anion | ChEBI |