EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17O8 |
| Net Charge | -1 |
| Average Mass | 337.304 |
| Monoisotopic Mass | 337.09289 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)O[C@@H]1C[C@](O)(C(=O)[O-])C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H18O8/c17-10-4-1-9(2-5-10)3-6-13(19)24-12-8-16(23,15(21)22)7-11(18)14(12)20/h1-6,11-12,14,17-18,20,23H,7-8H2,(H,21,22)/p-1/b6-3+/t11-,12-,14-,16+/m1/s1 |
| InChIKey | BMRSEYFENKXDIS-OTCYKTEZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-5-O-(4-coumaroyl)-D-quinate (CHEBI:57575) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| trans-5-O-(4-coumaroyl)-D-quinate (CHEBI:57575) is conjugate base of trans-5-O-(4-coumaroyl)-D-quinic acid (CHEBI:15937) |
| Incoming Relation(s) |
| trans-5-O-(4-coumaroyl)-D-quinic acid (CHEBI:15937) is conjugate acid of trans-5-O-(4-coumaroyl)-D-quinate (CHEBI:57575) |
| IUPAC Name |
|---|
| (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyloxy]cyclohexanecarboxylate |
| UniProt Name | Source |
|---|---|
| trans-5-O-(4-coumaroyl)-D-quinate | UniProt |