EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO2 |
| Net Charge | 0 |
| Average Mass | 157.213 |
| Monoisotopic Mass | 157.11028 |
| SMILES | C[N+]1(C)CCCCC1C(=O)[O-] |
| InChI | InChI=1S/C8H15NO2/c1-9(2)6-4-3-5-7(9)8(10)11/h7H,3-6H2,1-2H3 |
| InChIKey | XULZWQRXYTVUTE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Medicago sativa (ncbitaxon:3879) | - | PubMed (22208890) | |
| Citrus bergamia (ncbitaxon:380129) | - | PubMed (22208890) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homostachydrine (CHEBI:5757) has role plant metabolite (CHEBI:76924) |
| homostachydrine (CHEBI:5757) is a ammonium betaine (CHEBI:35284) |
| IUPAC Name |
|---|
| 1,1-dimethylpiperidinium-2-carboxylate |
| Synonym | Source |
|---|---|
| pipecolic acid betaine | ChEBI |
| Citations |
|---|