EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5O7 |
| Net Charge | -3 |
| Average Mass | 213.121 |
| Monoisotopic Mass | 213.00517 |
| SMILES | O=C([O-])CC(/C=C/C(=O)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H8O7/c9-5(8(14)15)2-1-4(7(12)13)3-6(10)11/h1-2,4H,3H2,(H,10,11)(H,12,13)(H,14,15)/p-3/b2-1+ |
| InChIKey | WHGVLEMQINVDLH-OWOJBTEDSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E)-5-oxopent-3-ene-1,2,5-tricarboxylate (CHEBI:57568) is a tricarboxylic acid trianion (CHEBI:27092) |
| (3E)-5-oxopent-3-ene-1,2,5-tricarboxylate (CHEBI:57568) is conjugate base of (3E)-5-oxopent-3-ene-1,2,5-tricarboxylic acid (CHEBI:47963) |
| Incoming Relation(s) |
| (3E)-5-oxopent-3-ene-1,2,5-tricarboxylic acid (CHEBI:47963) is conjugate acid of (3E)-5-oxopent-3-ene-1,2,5-tricarboxylate (CHEBI:57568) |
| IUPAC Name |
|---|
| (3E)-5-oxopent-3-ene-1,2,5-tricarboxylate |
| Synonym | Source |
|---|---|
| (3E)-5-oxopent-3-ene-1,2,5-tricarboxylate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| (3E)-5-oxopent-3-ene-1,2,5-tricarboxylate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5874023 | Beilstein |