EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N5O11P |
| Net Charge | -4 |
| Average Mass | 459.264 |
| Monoisotopic Mass | 459.04494 |
| SMILES | O=C([O-])CC(Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]1O)C(=O)[O-] |
| InChI | InChI=1S/C14H18N5O11P/c20-7(21)1-5(14(24)25)18-11-8-12(16-3-15-11)19(4-17-8)13-10(23)9(22)6(30-13)2-29-31(26,27)28/h3-6,9-10,13,22-23H,1-2H2,(H,20,21)(H,24,25)(H,15,16,18)(H2,26,27,28)/p-4/t5?,6-,9-,10-,13-/m1/s1 |
| InChIKey | OFBHPPMPBOJXRT-DPXQIYNJSA-J |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-(1,2-dicarboxylatoethyl)-AMP(4−) (CHEBI:57567) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| N6-(1,2-dicarboxylatoethyl)-AMP(4−) (CHEBI:57567) has role human metabolite (CHEBI:77746) |
| N6-(1,2-dicarboxylatoethyl)-AMP(4−) (CHEBI:57567) is a dicarboxylic acid dianion (CHEBI:28965) |
| N6-(1,2-dicarboxylatoethyl)-AMP(4−) (CHEBI:57567) is a organophosphate oxoanion (CHEBI:58945) |
| N6-(1,2-dicarboxylatoethyl)-AMP(4−) (CHEBI:57567) is conjugate base of N6-(1,2-dicarboxyethyl)-AMP (CHEBI:15919) |
| Incoming Relation(s) |
| N6-(1,2-dicarboxyethyl)-AMP (CHEBI:15919) is conjugate acid of N6-(1,2-dicarboxylatoethyl)-AMP(4−) (CHEBI:57567) |
| IUPAC Name |
|---|
| N-(1,2-dicarboxylatoethyl)-5'-O-phosphonatoadenosine |
| Synonym | Source |
|---|---|
| N6-(1,2-dicarboxylatoethyl)-AMP tetraanion | ChEBI |
| UniProt Name | Source |
|---|---|
| N6-(1,2-dicarboxyethyl)-AMP | UniProt |