EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13N2O6P |
| Net Charge | 0 |
| Average Mass | 228.141 |
| Monoisotopic Mass | 228.05112 |
| SMILES | [NH3+]CCOP(=O)([O-])OCC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H13N2O6P/c6-1-2-12-14(10,11)13-3-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)(H,10,11) |
| InChIKey | UQDJGEHQDNVPGU-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| serine phosphoethanolamine dizwitterion (CHEBI:57565) is a amino-acid zwitterion (CHEBI:35238) |
| serine phosphoethanolamine dizwitterion (CHEBI:57565) is tautomer of serine phosphoethanolamine (CHEBI:15916) |
| Incoming Relation(s) |
| serine phosphoethanolamine (CHEBI:15916) is tautomer of serine phosphoethanolamine dizwitterion (CHEBI:57565) |
| IUPAC Name |
|---|
| 2-azaniumyl-3-{[(2-azaniumylethyl) phosphinato]oxy}propanoate |
| Synonym | Source |
|---|---|
| 2-ammonio-3-{[(2-ammonioethoxy)phosphinato]oxy}propanoate | ChEBI |