EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N4O11P2 |
| Net Charge | -1 |
| Average Mass | 459.265 |
| Monoisotopic Mass | 459.06875 |
| SMILES | C[NH2+]CCOP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H22N4O11P2/c1-14-3-5-24-28(20,21)27-29(22,23)25-6-7-9(17)10(18)11(26-7)16-4-2-8(13)15-12(16)19/h2,4,7,9-11,14,17-18H,3,5-6H2,1H3,(H,20,21)(H,22,23)(H2,13,15,19)/p-1/t7-,9-,10-,11-/m1/s1 |
| InChIKey | RSPRLQAZJOAGFP-QCNRFFRDSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CDP-N-methylethanolamine(1−) (CHEBI:57547) is a organophosphate oxoanion (CHEBI:58945) |
| CDP-N-methylethanolamine(1−) (CHEBI:57547) is conjugate base of CDP-N-methylethanolamine (CHEBI:15868) |
| Incoming Relation(s) |
| CDP-N-methylethanolamine (CHEBI:15868) is conjugate acid of CDP-N-methylethanolamine(1−) (CHEBI:57547) |
| IUPAC Name |
|---|
| cytidine 5'-{3-[2-(methylazaniumyl)ethyl] diphosphate} |
| Synonym | Source |
|---|---|
| CDP-N-methylethanolamine anion | ChEBI |
| UniProt Name | Source |
|---|---|
| CDP-N-methylethanolamine | UniProt |