EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O6 |
| Net Charge | 0 |
| Average Mass | 316.309 |
| Monoisotopic Mass | 316.09469 |
| SMILES | COc1ccc(C2COc3cc(O)cc(O)c3C2=O)c(OC)c1 |
| InChI | InChI=1S/C17H16O6/c1-21-10-3-4-11(14(7-10)22-2)12-8-23-15-6-9(18)5-13(19)16(15)17(12)20/h3-7,12,18-19H,8H2,1-2H3 |
| InChIKey | LMLDNMHDNFCNCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homoferreirin (CHEBI:5754) has functional parent flavanone (CHEBI:5070) |
| homoferreirin (CHEBI:5754) has role plant metabolite (CHEBI:76924) |
| homoferreirin (CHEBI:5754) is a dihydroxyflavanone (CHEBI:38749) |
| homoferreirin (CHEBI:5754) is a dimethoxyflavanone (CHEBI:38743) |
| IUPAC Name |
|---|
| 3-(2,4-dimethoxyphenyl)-5,7-dihydroxy-2,3-dihydro-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 5,7-dihydroxy-2',4'-dimethoxyisoflavanone | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00002535 | KNApSAcK |
| C10457 | KEGG COMPOUND |
| HMDB0030111 | HMDB |
| LMPK12050502 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:332638 | Reaxys |
| CAS:482-01-9 | KEGG COMPOUND |