EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | COc1cc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)ccc1O |
| InChI | InChI=1S/C16H14O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-6,13,17-19H,7H2,1H3/t13-/m0/s1 |
| InChIKey | FTODBIPDTXRIGS-ZDUSSCGKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homoeriodictyol (CHEBI:74960) has functional parent eriodictyol (CHEBI:28412) |
| homoeriodictyol (CHEBI:74960) has role flavouring agent (CHEBI:35617) |
| homoeriodictyol (CHEBI:74960) has role metabolite (CHEBI:25212) |
| homoeriodictyol (CHEBI:74960) is a 3'-methoxyflavanones (CHEBI:140351) |
| homoeriodictyol (CHEBI:74960) is a 4'-hydroxyflavanones (CHEBI:140331) |
| homoeriodictyol (CHEBI:74960) is a monomethoxyflavanone (CHEBI:38738) |
| homoeriodictyol (CHEBI:74960) is a trihydroxyflavanone (CHEBI:38739) |
| Incoming Relation(s) |
| viscumneoside I (CHEBI:132856) has functional parent homoeriodictyol (CHEBI:74960) |
| viscumneoside III (CHEBI:132857) has functional parent homoeriodictyol (CHEBI:74960) |
| viscumneoside V (CHEBI:132859) has functional parent homoeriodictyol (CHEBI:74960) |
| viscumneoside VI (CHEBI:132860) has functional parent homoeriodictyol (CHEBI:74960) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Eriodictyol 3'-methyl ether | KEGG COMPOUND |
| 5,7,4'-Trihydroxy-3'-methoxyflavanone | ChemIDplus |
| (-)-Homoeriodictyol | ChemIDplus |
| (S)-2,3-Dihydro-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-benzopyrone | ChemIDplus |
| Eriodictyonone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (S)-homoeriodictyol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C09756 | KEGG COMPOUND |
| LMPK12140449 | LIPID MAPS |
| CPD-7071 | MetaCyc |
| Homoeriodictyol | Wikipedia |
| C00000969 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1294930 | Reaxys |
| CAS:446-71-9 | KEGG COMPOUND |
| CAS:446-71-9 | ChemIDplus |
| Citations |
|---|