EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H40O19 |
| Net Charge | 0 |
| Average Mass | 728.653 |
| Monoisotopic Mass | 728.21638 |
| SMILES | [H][C@]1(O)[C@H](OC[C@@]2(O)CO[C@@H](O[C@H]3[C@H](Oc4cc(O)c5c(c4)O[C@H](c4ccc(O)c(OC)c4)CC5=O)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@]2([H])O)OC[C@]1(O)CO |
| InChI | InChI=1S/C32H40O19/c1-44-19-4-13(2-3-15(19)35)18-7-17(37)22-16(36)5-14(6-20(22)49-18)48-28-25(24(39)23(38)21(8-33)50-28)51-30-27(41)32(43,12-47-30)11-46-29-26(40)31(42,9-34)10-45-29/h2-6,18,21,23-30,33-36,38-43H,7-12H2,1H3/t18-,21+,23+,24-,25+,26-,27-,28+,29-,30-,31+,32+/m0/s1 |
| InChIKey | HUBUCUOTSSVULF-UZTVYBTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Viscum coloratum (ncbitaxon:159976) | aerial part (BTO:0001658) | PubMed (3254039) | From stems & leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| viscumneoside V (CHEBI:132859) has functional parent homoeriodictyol (CHEBI:74960) |
| viscumneoside V (CHEBI:132859) has functional parent viscumneoside III (CHEBI:132857) |
| viscumneoside V (CHEBI:132859) has functional parent β-D-apiose (CHEBI:27672) |
| viscumneoside V (CHEBI:132859) has role plant metabolite (CHEBI:76924) |
| viscumneoside V (CHEBI:132859) is a flavanone glycoside (CHEBI:72730) |
| viscumneoside V (CHEBI:132859) is a viscumneoside (CHEBI:133718) |
| viscumneoside V (CHEBI:132859) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl 2-O-[(2S,3R,4R)-4-({[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]oxy}methyl)-3,4-dihydroxytetrahydrofuran-2-yl]-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| homoeriodictyol-7-β-D-apiosyl(1→5)-β-D-apiosyl(1→2)-β-D-glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00008443 | KNApSAcK |
| LMPK12140437 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23589040 | Reaxys |
| CAS:119016-92-1 | ChemIDplus |
| Citations |
|---|