EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6NO3 |
| Net Charge | -1 |
| Average Mass | 140.118 |
| Monoisotopic Mass | 140.03532 |
| SMILES | [H]C(=O)/C=C\C=C(\N)C(=O)[O-] |
| InChI | InChI=1S/C6H7NO3/c7-5(6(9)10)3-1-2-4-8/h1-4H,7H2,(H,9,10)/p-1/b2-1-,5-3+ |
| InChIKey | QCGTZPZKJPTAEP-REDYYMJGSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminomuconate 6-semialdehyde(1−) (CHEBI:57495) has role human metabolite (CHEBI:77746) |
| 2-aminomuconate 6-semialdehyde(1−) (CHEBI:57495) is a α-amino-acid anion (CHEBI:33558) |
| 2-aminomuconate 6-semialdehyde(1−) (CHEBI:57495) is conjugate base of 2-aminomuconic 6-semialdehyde (CHEBI:15745) |
| Incoming Relation(s) |
| 2-aminomuconic 6-semialdehyde (CHEBI:15745) is conjugate acid of 2-aminomuconate 6-semialdehyde(1−) (CHEBI:57495) |
| IUPAC Name |
|---|
| (2E,4Z)-2-amino-6-oxohexa-2,4-dienoate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10157394 | Beilstein |