EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O15P3 |
| Net Charge | -3 |
| Average Mass | 481.116 |
| Monoisotopic Mass | 480.94670 |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H15N2O15P3/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H,10,12,15)(H2,16,17,18)/p-3/t4-,6-,7-,8-/m1/s1 |
| InChIKey | PGAVKCOVUIYSFO-XVFCMESISA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UTP(3−) (CHEBI:57481) is a ribonucleoside triphosphate oxoanion (CHEBI:59724) |
| UTP(3−) (CHEBI:57481) is conjugate base of UTP (CHEBI:15713) |
| Incoming Relation(s) |
| UTP (CHEBI:15713) is conjugate acid of UTP(3−) (CHEBI:57481) |
| Synonym | Source |
|---|---|
| UTP trianion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3807363 | Beilstein |