EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13O5 |
| Net Charge | -1 |
| Average Mass | 285.275 |
| Monoisotopic Mass | 285.07685 |
| SMILES | COc1ccc(C2COc3cc([O-])cc(O)c3C2=O)cc1 |
| InChI | InChI=1S/C16H14O5/c1-20-11-4-2-9(3-5-11)12-8-21-14-7-10(17)6-13(18)15(14)16(12)19/h2-7,12,17-18H,8H2,1H3/p-1 |
| InChIKey | XPZQBSCTDLGDBP-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydrobiochanin A(1−) (CHEBI:57480) is a organic anion (CHEBI:25696) |
| 2,3-dihydrobiochanin A(1−) (CHEBI:57480) is conjugate base of 2,3-dihydrobiochanin A (CHEBI:15712) |
| Incoming Relation(s) |
| 2,3-dihydrobiochanin A (CHEBI:15712) is conjugate acid of 2,3-dihydrobiochanin A(1−) (CHEBI:57480) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(4-methoxyphenyl)-4-oxochroman-7-olate |
| Synonyms | Source |
|---|---|
| 2,3-dihydrobiochanin A anion | ChEBI |
| 5-hydroxy-3-(4-methoxyphenyl)-4-oxo-3,4-dihydro-2H-1-benzopyran-7-olate | ChEBI |