EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N4O6 |
| Net Charge | -1 |
| Average Mass | 289.268 |
| Monoisotopic Mass | 289.11536 |
| SMILES | [NH2+]=C(NCCC[C@H]([NH3+])C(=O)[O-])NC(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H18N4O6/c11-5(8(17)18)2-1-3-13-10(12)14-6(9(19)20)4-7(15)16/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H3,12,13,14)/p-1/t5-,6?/m0/s1 |
| InChIKey | KDZOASGQNOPSCU-ZBHICJROSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS87) | ||
| - | MetaboLights (MTBLS88) | ||
| - | MetaboLights (MTBLS127) | ||
| - | MetaboLights (MTBLS126) | ||
| - | MetaboLights (MTBLS125) | ||
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Nω-L-arginino)succinate(1−) (CHEBI:57472) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (Nω-L-arginino)succinate(1−) (CHEBI:57472) has role human metabolite (CHEBI:77746) |
| (Nω-L-arginino)succinate(1−) (CHEBI:57472) is a tricarboxylic acid anion (CHEBI:35753) |
| (Nω-L-arginino)succinate(1−) (CHEBI:57472) is conjugate base of (Nω-L-arginino)succinic acid (CHEBI:15682) |
| Incoming Relation(s) |
| (Nω-L-arginino)succinic acid (CHEBI:15682) is conjugate acid of (Nω-L-arginino)succinate(1−) (CHEBI:57472) |
| IUPAC Name |
|---|
| 2-{[{[(4S)-4-azaniumyl-4-carboxylatobutyl]amino}(iminiumyl)methyl]amino}butanedioate |
| Synonym | Source |
|---|---|
| 2-{[{[(4S)-4-ammonio-4-carboxylatobutyl]amino}(iminio)methyl]amino}succinate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-(Nω-L-arginino)succinate | UniProt |