EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3O7 |
| Net Charge | -3 |
| Average Mass | 199.094 |
| Monoisotopic Mass | 198.98952 |
| SMILES | O=C([O-])/C=C(\CC(=O)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H6O7/c8-4(7(13)14)1-3(6(11)12)2-5(9)10/h2H,1H2,(H,9,10)(H,11,12)(H,13,14)/p-3/b3-2+ |
| InChIKey | ODTDYYZJDQGKQT-NSCUHMNNSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1E)-4-oxobut-1-ene-1,2,4-tricarboxylate (CHEBI:57471) is a tricarboxylic acid trianion (CHEBI:27092) |
| (1E)-4-oxobut-1-ene-1,2,4-tricarboxylate (CHEBI:57471) is conjugate base of (1E)-4-oxobut-1-ene-1,2,4-tricarboxylic acid (CHEBI:15668) |
| Incoming Relation(s) |
| (1E)-4-oxobut-1-ene-1,2,4-tricarboxylic acid (CHEBI:15668) is conjugate acid of (1E)-4-oxobut-1-ene-1,2,4-tricarboxylate (CHEBI:57471) |
| IUPAC Name |
|---|
| (1E)-4-oxobut-1-ene-1,2,4-tricarboxylate |
| UniProt Name | Source |
|---|---|
| (1E)-4-oxobut-1-ene-1,2,4-tricarboxylate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1124055 | Beilstein |