EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO3 |
| Net Charge | 0 |
| Average Mass | 275.348 |
| Monoisotopic Mass | 275.15214 |
| SMILES | [H][C@]12CC[C@]([H])(C[C@H](OC(=O)C(O)c3ccccc3)C1)N2C |
| InChI | InChI=1S/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12-,13+,14+,15? |
| InChIKey | ZTVIKZXZYLEVOL-MCOXGKPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Homatropine (CHEBI:5747) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| homatropin | DrugCentral |
| (+/-)-Homatropine | DrugCentral |
| Homatropine | KEGG COMPOUND |
| homatropine hydrobromide | DrugCentral |
| homatropine sulfate | DrugCentral |
| homoatropine | DrugCentral |