EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O6 |
| Net Charge | -2 |
| Average Mass | 186.119 |
| Monoisotopic Mass | 186.01754 |
| SMILES | COC(=O)C/C(=C\C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H8O6/c1-13-6(10)3-4(7(11)12)2-5(8)9/h2H,3H2,1H3,(H,8,9)(H,11,12)/p-2/b4-2+ |
| InChIKey | MRNZYUAGJLJQAM-DUXPYHPUSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-2-(methoxycarbonylmethyl)but-2-enedioate(2−) (CHEBI:57469) is a dicarboxylic acid dianion (CHEBI:28965) |
| (2E)-2-(methoxycarbonylmethyl)but-2-enedioate(2−) (CHEBI:57469) is conjugate base of (2E)-2-(methoxycarbonylmethyl)but-2-enedioic acid (CHEBI:15661) |
| Incoming Relation(s) |
| (2E)-2-(methoxycarbonylmethyl)but-2-enedioic acid (CHEBI:15661) is conjugate acid of (2E)-2-(methoxycarbonylmethyl)but-2-enedioate(2−) (CHEBI:57469) |
| IUPAC Name |
|---|
| (2E)-2-(2-methoxy-2-oxoethyl)but-2-enedioate |
| Synonym | Source |
|---|---|
| (2E)-2-(methoxycarbonylmethyl)but-2-enedioate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| (E)-2-(methoxycarbonylmethyl)but-2-enedioate | UniProt |