EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31O4 |
| Net Charge | -1 |
| Average Mass | 311.442 |
| Monoisotopic Mass | 311.22278 |
| SMILES | CCCCC/C=C\C/C=C\[C@H](O)[C@@H](O)CCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H32O4/c1-2-3-4-5-6-7-8-10-13-16(19)17(20)14-11-9-12-15-18(21)22/h6-7,10,13,16-17,19-20H,2-5,8-9,11-12,14-15H2,1H3,(H,21,22)/p-1/b7-6-,13-10-/t16-,17-/m0/s1 |
| InChIKey | NMONGVDUESEHOK-MPOZZNMKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7(S),8(S)-DiHODE(1−) (CHEBI:57468) is a 7,8-DiHODE(1−) (CHEBI:194418) |
| 7(S),8(S)-DiHODE(1−) (CHEBI:57468) is conjugate base of 7(S),8(S)-DiHODE (CHEBI:15658) |
| Incoming Relation(s) |
| 7(S),8(S)-DiHODE (CHEBI:15658) is conjugate acid of 7(S),8(S)-DiHODE(1−) (CHEBI:57468) |
| IUPAC Name |
|---|
| (7S,8S,9Z,12Z)-7,8-dihydroxyoctadeca-9,12-dienoate |
| Synonym | Source |
|---|---|
| 7(S),8(S)-DiHODE anion | ChEBI |
| UniProt Name | Source |
|---|---|
| (7S,8S,9Z,12Z)-7,8-dihydroxyoctadeca-9,12-dienoate | UniProt |
| Citations |
|---|