EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:57453 - (6S)-5,6,7,8-tetrahydrofolate(2−)
| Formula | C19H21N7O6 |
| Net Charge | -2 |
| Average Mass | 443.420 |
| Monoisotopic Mass | 443.15643 |
| SMILES | Nc1nc2c(c(=O)n1)N[C@@H](CNc1ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc1)CN2 |
| InChI | InChI=1S/C19H23N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,11-12,21,23H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/p-2/t11-,12-/m0/s1 |
| InChIKey | MSTNYGQPCMXVAQ-RYUDHWBXSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6S)-5,6,7,8-tetrahydrofolate(2−) (CHEBI:57453) has role cofactor (CHEBI:23357) |
| (6S)-5,6,7,8-tetrahydrofolate(2−) (CHEBI:57453) has role human metabolite (CHEBI:77746) |
| (6S)-5,6,7,8-tetrahydrofolate(2−) (CHEBI:57453) is a dicarboxylic acid dianion (CHEBI:28965) |
| (6S)-5,6,7,8-tetrahydrofolate(2−) (CHEBI:57453) is conjugate base of (6S)-5,6,7,8-tetrahydrofolic acid (CHEBI:15635) |
| Incoming Relation(s) |
| (6S)-5,6,7,8-tetrahydrofolic acid (CHEBI:15635) is conjugate acid of (6S)-5,6,7,8-tetrahydrofolate(2−) (CHEBI:57453) |
| IUPAC Name |
|---|
| N-[4-({[(6S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamate |
| Synonym | Source |
|---|---|
| (6S)-5,6,7,8-tetrahydrofolate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| (6S)-5,6,7,8-tetrahydrofolate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10223255 | Beilstein |