EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O4 |
| Net Charge | -1 |
| Average Mass | 335.464 |
| Monoisotopic Mass | 335.22278 |
| SMILES | CCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)[O-])OO |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-10-13-16-19(24-23)17-14-11-8-6-7-9-12-15-18-20(21)22/h7-11,13-14,17,19,23H,2-6,12,15-16,18H2,1H3,(H,21,22)/p-1/b9-7-,11-8-,13-10-,17-14+/t19-/m0/s1 |
| InChIKey | ZIOZYRSDNLNNNJ-LQWMCKPYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12(S)-HPETE(1−) (CHEBI:57444) has role human metabolite (CHEBI:77746) |
| 12(S)-HPETE(1−) (CHEBI:57444) is a HPETE anion (CHEBI:59720) |
| 12(S)-HPETE(1−) (CHEBI:57444) is conjugate base of 12(S)-HPETE (CHEBI:15626) |
| Incoming Relation(s) |
| 12(S)-HPETE (CHEBI:15626) is conjugate acid of 12(S)-HPETE(1−) (CHEBI:57444) |
| IUPAC Name |
|---|
| (5Z,8Z,10E,12S,14Z)-12-hydroperoxyicosa-5,8,10,14-tetraenoate |
| Synonym | Source |
|---|---|
| 12(S)-HPETE anion | ChEBI |
| UniProt Name | Source |
|---|---|
| (12S)-hydroperoxy-(5Z,8Z,10E,14Z)-eicosatetraenoate | UniProt |