EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CC(C)C[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | ROHFNLRQFUQHCH-YFKPBYRVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-leucine zwitterion (CHEBI:57427) is a amino-acid zwitterion (CHEBI:35238) |
| L-leucine zwitterion (CHEBI:57427) is tautomer of L-leucine (CHEBI:15603) |
| Incoming Relation(s) |
| L-leucine (CHEBI:15603) is tautomer of L-leucine zwitterion (CHEBI:57427) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-4-methylpentanoate |
| Synonym | Source |
|---|---|
| leucine zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-leucine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:363609 | Gmelin |