EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O5 |
| Net Charge | -1 |
| Average Mass | 351.463 |
| Monoisotopic Mass | 351.21770 |
| SMILES | CCCCCC(=O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,16-17,19,23H,2-11,14H2,1H3,(H,24,25)/p-1/b13-12+/t16-,17-,19-/m1/s1 |
| InChIKey | VXPBDCBTMSKCKZ-XQHNHVHJSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-dehydro-prostaglandin E1(1−) (CHEBI:57401) has role human metabolite (CHEBI:77746) |
| 15-dehydro-prostaglandin E1(1−) (CHEBI:57401) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| 15-dehydro-prostaglandin E1(1−) (CHEBI:57401) is conjugate base of 15-dehydro-prostaglandin E1 (CHEBI:15548) |
| Incoming Relation(s) |
| 15-dehydro-prostaglandin E1 (CHEBI:15548) is conjugate acid of 15-dehydro-prostaglandin E1(1−) (CHEBI:57401) |
| IUPAC Name |
|---|
| (13E)-11α-hydroxy-9,15-dioxoprost-13-en-1-oate |
| Synonym | Source |
|---|---|
| 15-dehydro-prostaglandin E1 anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 15-oxoprostaglandin E1 | UniProt |