EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O4 |
| Net Charge | -1 |
| Average Mass | 335.464 |
| Monoisotopic Mass | 335.22278 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C=CC(=O)[C@@H]1CCCCCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h12-18,21H,2-11H2,1H3,(H,23,24)/p-1/b14-12+/t16-,17-,18+/m0/s1 |
| InChIKey | BGKHCLZFGPIKKU-LDDQNKHRSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin A1(1−) (CHEBI:57398) has role human metabolite (CHEBI:77746) |
| prostaglandin A1(1−) (CHEBI:57398) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin A1(1−) (CHEBI:57398) is conjugate base of prostaglandin A1 (CHEBI:15545) |
| Incoming Relation(s) |
| 15-dehydroprostaglandin A1(1−) (CHEBI:85072) has functional parent prostaglandin A1(1−) (CHEBI:57398) |
| 20-hydroxyprostaglandin A1(1−) (CHEBI:136663) has functional parent prostaglandin A1(1−) (CHEBI:57398) |
| prostaglandin A1 (CHEBI:15545) is conjugate acid of prostaglandin A1(1−) (CHEBI:57398) |
| IUPAC Name |
|---|
| (13E,15S)-15-hydroxy-9-oxoprosta-10,13-dien-1-oate |
| Synonym | Source |
|---|---|
| prostaglandin A1 anion | ChEBI |
| UniProt Name | Source |
|---|---|
| prostaglandin A1 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| DB06733 | DrugBank |