EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38N7O18P3S |
| Net Charge | -4 |
| Average Mass | 909.654 |
| Monoisotopic Mass | 909.12288 |
| SMILES | CC(C)(COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-])[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C30H42N7O18P3S/c1-30(2,25(42)28(43)33-10-9-20(39)32-11-12-59-21(40)8-5-17-3-6-18(38)7-4-17)14-52-58(49,50)55-57(47,48)51-13-19-24(54-56(44,45)46)23(41)29(53-19)37-16-36-22-26(31)34-15-35-27(22)37/h3-8,15-16,19,23-25,29,38,41-42H,9-14H2,1-2H3,(H,32,39)(H,33,43)(H,47,48)(H,49,50)(H2,31,34,35)(H2,44,45,46)/p-4/t19-,23-,24-,25+,29-/m1/s1 |
| InChIKey | DMZOKBALNZWDKI-FUEUKBNZSA-J |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-coumaroyl-CoA(4−) (CHEBI:57355) has role human metabolite (CHEBI:77746) |
| 4-coumaroyl-CoA(4−) (CHEBI:57355) is a acyl-CoA(4−) (CHEBI:58342) |
| 4-coumaroyl-CoA(4−) (CHEBI:57355) is conjugate base of 4-coumaroyl-CoA (CHEBI:15499) |
| Incoming Relation(s) |
| trans-4-coumaroyl-CoA(4−) (CHEBI:85008) is a 4-coumaroyl-CoA(4−) (CHEBI:57355) |
| 4-coumaroyl-CoA (CHEBI:15499) is conjugate acid of 4-coumaroyl-CoA(4−) (CHEBI:57355) |
| IUPAC Name |
|---|
| 3'-phosphonatoadenosine 5'-{3-[(3R)-3-hydroxy-4-({3-[(2-{[3-(4-hydroxyphenyl)prop-2-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] diphosphate} |
| UniProt Name | Source |
|---|---|
| 4-coumaroyl-CoA | UniProt |