EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N7O19P3S |
| Net Charge | -5 |
| Average Mass | 888.612 |
| Monoisotopic Mass | 888.11052 |
| SMILES | C/C(=C\C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-])CC(=O)[O-] |
| InChI | InChI=1S/C27H42N7O19P3S/c1-14(8-17(36)37)9-18(38)57-7-6-29-16(35)4-5-30-25(41)22(40)27(2,3)11-50-56(47,48)53-55(45,46)49-10-15-21(52-54(42,43)44)20(39)26(51-15)34-13-33-19-23(28)31-12-32-24(19)34/h9,12-13,15,20-22,26,39-40H,4-8,10-11H2,1-3H3,(H,29,35)(H,30,41)(H,36,37)(H,45,46)(H,47,48)(H2,28,31,32)(H2,42,43,44)/p-5/b14-9+/t15-,20-,21-,22+,26-/m1/s1 |
| InChIKey | GXKSHRDAHFLWPN-RKYLSHMCSA-I |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-3-methylglutaconyl-CoA(5−) (CHEBI:57346) has role human metabolite (CHEBI:77746) |
| trans-3-methylglutaconyl-CoA(5−) (CHEBI:57346) is a acyl-CoA oxoanion (CHEBI:58946) |
| trans-3-methylglutaconyl-CoA(5−) (CHEBI:57346) is a ω-carboxy-(fatty acyl)-CoA(5−) (CHEBI:177898) |
| trans-3-methylglutaconyl-CoA(5−) (CHEBI:57346) is conjugate base of trans-3-methylglutaconyl-CoA (CHEBI:15488) |
| Incoming Relation(s) |
| trans-3-methylglutaconyl-CoA (CHEBI:15488) is conjugate acid of trans-3-methylglutaconyl-CoA(5−) (CHEBI:57346) |
| IUPAC Name |
|---|
| 3'-phosphonatoadenosine 5'-{3-[(3R)-4-({3-[(2-{[(2E)-4-carboxylato-3-methylbut-2-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] diphosphate} |
| Synonyms | Source |
|---|---|
| (E)-3-methylglutaconyl-1-CoA(5−) | ChEBI |
| trans-3-methylglutaconyl-coenzyme A(5−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-methyl-(2E)-glutaconyl-CoA | UniProt |
| Manual Xrefs | Databases |
|---|---|
| TRANS-3-METHYL-GLUTACONYL-COA | MetaCyc |