EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38N7O17P3S |
| Net Charge | -4 |
| Average Mass | 845.611 |
| Monoisotopic Mass | 845.12797 |
| SMILES | C/C=C(\C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C26H42N7O17P3S/c1-5-14(2)25(38)54-9-8-28-16(34)6-7-29-23(37)20(36)26(3,4)11-47-53(44,45)50-52(42,43)46-10-15-19(49-51(39,40)41)18(35)24(48-15)33-13-32-17-21(27)30-12-31-22(17)33/h5,12-13,15,18-20,24,35-36H,6-11H2,1-4H3,(H,28,34)(H,29,37)(H,42,43)(H,44,45)(H2,27,30,31)(H2,39,40,41)/p-4/b14-5+/t15-,18-,19-,20+,24-/m1/s1 |
| InChIKey | PMWATMXOQQZNBX-DKBZLLMOSA-J |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylcrotonoyl-CoA(4−) (CHEBI:57337) has role human metabolite (CHEBI:77746) |
| 2-methylcrotonoyl-CoA(4−) (CHEBI:57337) is a 2-methylbut-2-enoyl-CoA(4−) (CHEBI:57260) |
| 2-methylcrotonoyl-CoA(4−) (CHEBI:57337) is conjugate base of 2-methylcrotonoyl-CoA (CHEBI:15478) |
| Incoming Relation(s) |
| 2-methylcrotonoyl-CoA (CHEBI:15478) is conjugate acid of 2-methylcrotonoyl-CoA(4−) (CHEBI:57337) |
| IUPAC Name |
|---|
| 3'-phosphonatoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[(2E)-2-methylbut-2-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] diphosphate} |
| UniProt Name | Source |
|---|---|
| (2E)-2-methylbut-2-enoyl-CoA | UniProt |